CAS 946385-86-0

6-(4-Bromophenyl)-4,5-dihydro-4-(1-methyl-1H-indol-3-yl)-3(2H)-pyridazinone

Description:

6-(4-Bromophenyl)-4,5-dihydro-4-(1-methyl-1H-indol-3-yl)-3(2H)-pyridazinone is a chemical compound characterized by its complex structure, which includes a pyridazinone core, a bromophenyl group, and an indole moiety. This compound typically exhibits properties such as moderate solubility in organic solvents and potential bioactivity due to its structural features, which may interact with biological targets. The presence of the bromine atom can influence its electronic properties and reactivity, while the indole group is often associated with various pharmacological activities. The compound may be of interest in medicinal chemistry for its potential therapeutic applications, particularly in the development of new drugs. Its molecular structure suggests it could participate in hydrogen bonding and π-π stacking interactions, which are relevant in biological systems. As with many organic compounds, stability, reactivity, and solubility can vary based on environmental conditions and the presence of other chemical species.

Formula: C₁₉H₁₆BrN₃O

InChI: InChI=1S/C19H16BrN3O/c1-23-11-16(14-4-2-3-5-18(14)23)15-10-17(21-22-19(15)24)12-6-8-13(20)9-7-12/h2-9,11,15H,10H2,1H3,(H,22,24)

InChI key: InChIKey=FQZJJXGMGFMMAR-UHFFFAOYSA-N

SMILES: O=C1C(C=2C=3C(N(C)C2)=CC=CC3)CC(=NN1)C4=CC=C(Br)C=C4

Synonyms:

• 6-(4-Bromophenyl)-4,5-dihydro-4-(1-methyl-1H-indol-3-yl)-3(2H)-pyridazinone
• 3(2H)-Pyridazinone, 6-(4-bromophenyl)-4,5-dihydro-4-(1-methyl-1H-indol-3-yl)-

3-(4-bromophenyl)-5-(1-methylindol-3-yl)-1H,4H,5H-1,2-diazin-6-one

CAS: 946385-86-0

Please enquire for more information about 3-(4-bromophenyl)-5-(1-methylindol-3-yl)-1H,4H,5H-1,2-diazin-6-one including the price, delivery time and more detailed product information at the technical inquiry form on this page

Purity: Min. 95%

Ref: 3D-FB169865