CAS 946386-16-9

3-[(3,5-Dichlorophenyl)amino]-2-phenyl-1H-inden-1-one

Description:

3-[(3,5-Dichlorophenyl)amino]-2-phenyl-1H-inden-1-one, with the CAS number 946386-16-9, is an organic compound characterized by its complex structure, which includes an indene core substituted with both a phenyl group and a dichlorophenylamino moiety. This compound typically exhibits properties associated with aromatic compounds, such as stability and potential for engaging in electrophilic substitution reactions. The presence of the dichlorophenyl group suggests that it may have enhanced lipophilicity and biological activity, potentially making it a candidate for pharmaceutical applications. The compound's structure may also confer specific electronic properties, influencing its reactivity and interaction with biological targets. Additionally, due to the presence of chlorine atoms, it may exhibit unique solubility characteristics in various solvents. Overall, this compound's unique structural features and substituents contribute to its potential utility in medicinal chemistry and material science.

Formula: C₂₁H₁₃Cl₂NO

InChI: InChI=1S/C21H13Cl2NO/c22-14-10-15(23)12-16(11-14)24-20-17-8-4-5-9-18(17)21(25)19(20)13-6-2-1-3-7-13/h1-12,24H

InChI key: InChIKey=CCNZHWQCFOJCER-UHFFFAOYSA-N

SMILES: N(C1=C(C(=O)C=2C1=CC=CC2)C3=CC=CC=C3)C4=CC(Cl)=CC(Cl)=C4

Synonyms:

• 3-[(3,5-Dichlorophenyl)amino]-2-phenyl-1H-inden-1-one
• 1H-Inden-1-one, 3-[(3,5-dichlorophenyl)amino]-2-phenyl-