CAS 946386-52-3

3-(1,1-Dimethylethyl)-6-nitroindeno[1,2-c]pyrazol-4(2H)-one

Description:

3-(1,1-Dimethylethyl)-6-nitroindeno[1,2-c]pyrazol-4(2H)-one is a chemical compound characterized by its complex structure, which includes an indeno[1,2-c]pyrazole core. This compound features a nitro group at the 6-position and a tert-butyl group at the 3-position, contributing to its unique chemical properties. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific solvent and conditions. The presence of the nitro group suggests potential reactivity, particularly in electrophilic substitution reactions. Additionally, the tert-butyl group can influence the compound's steric hindrance and overall stability. This compound may have applications in medicinal chemistry or material science, although specific uses would depend on further research into its biological activity and chemical behavior. Safety data and handling precautions should be considered, as with any chemical substance, particularly those with nitro groups, which can be sensitive to heat and shock.

Formula: C₁₄H₁₃N₃O₃

InChI: InChI=1S/C14H13N3O3/c1-14(2,3)13-10-11(15-16-13)8-5-4-7(17(19)20)6-9(8)12(10)18/h4-6H,1-3H3,(H,15,16)

InChI key: InChIKey=UOSPNLXQBIJRTC-UHFFFAOYSA-N

SMILES: C(C)(C)(C)C1=C2C(C=3C(C2=O)=CC(N(=O)=O)=CC3)=NN1

Synonyms:

• 3-(1,1-Dimethylethyl)-6-nitroindeno[1,2-c]pyrazol-4(2H)-one
• Indeno[1,2-c]pyrazol-4(2H)-one, 3-(1,1-dimethylethyl)-6-nitro-

3-(tert-butyl)-6-nitroindeno[3,2-c]pyrazol-4-one

CAS: 946386-52-3

Please enquire for more information about 3-(tert-butyl)-6-nitroindeno[3,2-c]pyrazol-4-one including the price, delivery time and more detailed product information at the technical inquiry form on this page

Purity: Min. 95%

Ref: 3D-FB169679