CAS 946386-56-7
:2-Phenoxy-N-(4,5,6,7-tetrahydro-5,5-dimethyl-7-oxo-2-benzothiazolyl)-3-pyridinecarboxamide
Description:
2-Phenoxy-N-(4,5,6,7-tetrahydro-5,5-dimethyl-7-oxo-2-benzothiazolyl)-3-pyridinecarboxamide is a synthetic organic compound characterized by its complex structure, which includes a phenoxy group, a pyridinecarboxamide moiety, and a tetrahydro-benzothiazole derivative. This compound typically exhibits properties such as moderate solubility in organic solvents and limited solubility in water, which is common for many organic amides. Its molecular structure suggests potential biological activity, possibly as a pharmaceutical agent, due to the presence of functional groups that can interact with biological targets. The benzothiazole and pyridine components may contribute to its pharmacological properties, including potential antimicrobial or anti-inflammatory effects. The compound's stability and reactivity can be influenced by environmental factors such as pH and temperature. As with many synthetic compounds, safety data should be consulted to understand its toxicity and handling requirements. Overall, 2-Phenoxy-N-(4,5,6,7-tetrahydro-5,5-dimethyl-7-oxo-2-benzothiazolyl)-3-pyridinecarboxamide represents a class of compounds with potential applications in medicinal chemistry.
Formula:C21H19N3O3S
InChI:InChI=1S/C21H19N3O3S/c1-21(2)11-15-17(16(25)12-21)28-20(23-15)24-18(26)14-9-6-10-22-19(14)27-13-7-4-3-5-8-13/h3-10H,11-12H2,1-2H3,(H,23,24,26)
InChI key:InChIKey=IHFNEDSIXIPMSB-UHFFFAOYSA-N
SMILES:O=C1C2=C(N=C(NC(=O)C3=C(OC4=CC=CC=C4)N=CC=C3)S2)CC(C)(C)C1
Synonyms:- 2-Phenoxy-N-(4,5,6,7-tetrahydro-5,5-dimethyl-7-oxo-2-benzothiazolyl)-3-pyridinecarboxamide
- 3-Pyridinecarboxamide, 2-phenoxy-N-(4,5,6,7-tetrahydro-5,5-dimethyl-7-oxo-2-benzothiazolyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.