CAS 946386-69-2

1,2,3,4-Tetrahydro-2,3-diphenyl-5-quinoxalinecarboxylic acid

Description:

1,2,3,4-Tetrahydro-2,3-diphenyl-5-quinoxalinecarboxylic acid is a chemical compound characterized by its unique structure, which includes a quinoxaline core fused with a tetrahydro ring and two phenyl groups. This compound typically exhibits properties associated with both heterocyclic compounds and carboxylic acids, such as potential acidity due to the carboxylic acid functional group. Its molecular structure suggests it may have applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of the quinoxaline moiety, which is known for various biological activities. The compound may also display interesting physical properties, including solubility characteristics influenced by the presence of the phenyl groups and the carboxylic acid. Additionally, its synthesis and reactivity can be of interest in organic chemistry, particularly in the context of creating derivatives or exploring its potential as a ligand in coordination chemistry. Overall, this compound represents a fascinating area of study within the realm of organic and medicinal chemistry.

Formula: C₂₁H₁₈N₂O₂

InChI: InChI=1S/C21H18N2O2/c24-21(25)16-12-7-13-17-20(16)23-19(15-10-5-2-6-11-15)18(22-17)14-8-3-1-4-9-14/h1-13,18-19,22-23H,(H,24,25)

InChI key: InChIKey=CGCADNMILNKOBY-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=C2NC(C(NC2=CC=C1)C3=CC=CC=C3)C4=CC=CC=C4

Synonyms:

• 5-Quinoxalinecarboxylic acid, 1,2,3,4-tetrahydro-2,3-diphenyl-
• 1,2,3,4-Tetrahydro-2,3-diphenyl-5-quinoxalinecarboxylic acid