CymitQuimica logo

CAS 946386-84-1

:

N′-[2-(1H-Indol-3-yl)ethyl]-N-[4-(trifluoromethoxy)phenyl]thiourea

Description:
N′-[2-(1H-Indol-3-yl)ethyl]-N-[4-(trifluoromethoxy)phenyl]thiourea, with CAS number 946386-84-1, is a synthetic organic compound characterized by its unique structural features, which include an indole moiety and a trifluoromethoxy-substituted phenyl group. This compound typically exhibits properties associated with thioureas, such as potential biological activity, including anti-cancer and anti-inflammatory effects, due to the presence of the indole structure, which is known for its role in various pharmacological activities. The trifluoromethoxy group enhances lipophilicity and may influence the compound's interaction with biological targets. In terms of solubility, thioureas often show moderate solubility in organic solvents, and the presence of fluorine atoms can affect the compound's stability and reactivity. Overall, this compound's characteristics suggest it may be of interest in medicinal chemistry and drug development, particularly in the context of designing novel therapeutic agents. However, specific experimental data would be necessary to fully elucidate its properties and potential applications.
Formula:C18H16F3N3OS
InChI:InChI=1S/C18H16F3N3OS/c19-18(20,21)25-14-7-5-13(6-8-14)24-17(26)22-10-9-12-11-23-16-4-2-1-3-15(12)16/h1-8,11,23H,9-10H2,(H2,22,24,26)
InChI key:InChIKey=ZXDPCUGKCAYSRY-UHFFFAOYSA-N
SMILES:C(CNC(NC1=CC=C(OC(F)(F)F)C=C1)=S)C=2C=3C(NC2)=CC=CC3
Synonyms:
  • N′-[2-(1H-Indol-3-yl)ethyl]-N-[4-(trifluoromethoxy)phenyl]thiourea
  • Thiourea, N′-[2-(1H-indol-3-yl)ethyl]-N-[4-(trifluoromethoxy)phenyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.