CAS 946387-03-7

α-Oxo-N-8-quinolinyl-1H-indole-3-acetamide

Description:

α-Oxo-N-8-quinolinyl-1H-indole-3-acetamide is a chemical compound characterized by its complex structure, which includes an indole moiety and a quinoline ring. This compound typically exhibits properties associated with both heterocyclic compounds and amides, such as potential biological activity and solubility in organic solvents. The presence of the α-oxo group suggests reactivity that may facilitate various chemical transformations, while the quinolinyl and indole components may contribute to its pharmacological properties. Compounds of this nature are often investigated for their potential as pharmaceuticals, particularly in the fields of oncology and neurology, due to their ability to interact with biological targets. Additionally, the specific arrangement of functional groups can influence the compound's lipophilicity, stability, and interaction with enzymes or receptors. Overall, α-Oxo-N-8-quinolinyl-1H-indole-3-acetamide represents a class of compounds with significant interest in medicinal chemistry and drug development.

Formula: C₁₉H₁₃N₃O₂

InChI: InChI=1S/C19H13N3O2/c23-18(14-11-21-15-8-2-1-7-13(14)15)19(24)22-16-9-3-5-12-6-4-10-20-17(12)16/h1-11,21H,(H,22,24)

InChI key: InChIKey=FMFHAOSZZKQHSE-UHFFFAOYSA-N

SMILES: C(C(NC=1C2=C(C=CC1)C=CC=N2)=O)(=O)C=3C=4C(NC3)=CC=CC4

Synonyms:

• α-Oxo-N-8-quinolinyl-1H-indole-3-acetamide
• 1H-Indole-3-acetamide, α-oxo-N-8-quinolinyl-
• 2-INDOL-3-YL-2-OXO-N-(8-QUINOLYL)ETHANAMIDE
• 2-(1H-indol-3-yl)-2-oxo-N-(quinolin-8-yl)acetamide

2-Indol-3-yl-2-oxo-N-(8-quinolyl)ethanamide

CAS: 946387-03-7

Please enquire for more information about 2-Indol-3-yl-2-oxo-N-(8-quinolyl)ethanamide including the price, delivery time and more detailed product information at the technical inquiry form on this page

Formula: C₁₉H₁₃N₃O₂

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 315.33 g/mol

Ref: 3D-FI169634