CAS 946387-08-2
:4-Chloro-1,2-dihydro-1-methyl-2-phenyl-5-[[3-(trifluoromethyl)phenoxy]methyl]-3H-pyrazol-3-one
Description:
4-Chloro-1,2-dihydro-1-methyl-2-phenyl-5-[[3-(trifluoromethyl)phenoxy]methyl]-3H-pyrazol-3-one is a complex organic compound characterized by its pyrazolone core, which features a chloro substituent and a trifluoromethyl group. This compound exhibits a range of chemical properties typical of pyrazolones, including potential reactivity due to the presence of the carbonyl group and the electron-withdrawing trifluoromethyl group, which can influence its electronic properties and reactivity. The presence of the phenyl and trifluoromethyl groups may enhance lipophilicity, affecting its solubility in organic solvents. Additionally, the compound may exhibit biological activity, making it of interest in pharmaceutical research. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of new therapeutic agents. The compound's stability, reactivity, and potential interactions with biological targets would be important considerations in any practical applications or studies involving this substance.
Formula:C18H14ClF3N2O2
InChI:InChI=1S/C18H14ClF3N2O2/c1-23-15(11-26-14-9-5-6-12(10-14)18(20,21)22)16(19)17(25)24(23)13-7-3-2-4-8-13/h2-10H,11H2,1H3
InChI key:InChIKey=VNUZJHTVQVWOOO-UHFFFAOYSA-N
SMILES:CN1N(C(=O)C(Cl)=C1COC2=CC(C(F)(F)F)=CC=C2)C3=CC=CC=C3
Synonyms:- 4-Chloro-1,2-dihydro-1-methyl-2-phenyl-5-[[3-(trifluoromethyl)phenoxy]methyl]-3H-pyrazol-3-one
- 3H-Pyrazol-3-one, 4-chloro-1,2-dihydro-1-methyl-2-phenyl-5-[[3-(trifluoromethyl)phenoxy]methyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.