CAS 946409-30-9

2-(4-Methyl-1-piperazinyl)-5-thiazolecarboxylic acid

Description:

2-(4-Methyl-1-piperazinyl)-5-thiazolecarboxylic acid is a chemical compound characterized by its unique structure, which includes a thiazole ring and a piperazine moiety. This compound typically exhibits properties such as being a solid at room temperature and having moderate solubility in polar solvents due to the presence of both hydrophobic and hydrophilic groups. The thiazole ring contributes to its potential biological activity, often associated with antimicrobial or anti-inflammatory properties. The piperazine group can enhance the compound's ability to interact with biological targets, making it of interest in medicinal chemistry. Additionally, the carboxylic acid functional group can participate in hydrogen bonding, influencing its reactivity and interaction with other molecules. Overall, this compound's characteristics make it a subject of interest for further research in pharmaceutical applications and chemical synthesis.

Formula: C₉H₁₃N₃O₂S

InChI: InChI=1S/C9H13N3O2S/c1-11-2-4-12(5-3-11)9-10-6-7(15-9)8(13)14/h6H,2-5H2,1H3,(H,13,14)

InChI key: InChIKey=RKJMEAAQLUOZLB-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1SC(=NC1)N2CCN(C)CC2

Synonyms:

• 5-Thiazolecarboxylic acid, 2-(4-methyl-1-piperazinyl)-
• 2-(4-Methyl-1-piperazinyl)-5-thiazolecarboxylic acid
• 2-(4-Methylpiperazin-1-yl)-1,3-thiazole-5-carboxylic acid