
CAS 946426-90-0
:5-Cyclopropyl-3-[2-(trifluoromethoxy)phenyl]-4-isoxazolemethanol
Description:
5-Cyclopropyl-3-[2-(trifluoromethoxy)phenyl]-4-isoxazolemethanol is a chemical compound characterized by its unique structural features, which include a cyclopropyl group, an isoxazole ring, and a trifluoromethoxy substituent. The presence of the isoxazole moiety suggests potential biological activity, as isoxazoles are often found in pharmacologically active compounds. The trifluoromethoxy group enhances lipophilicity and may influence the compound's interaction with biological targets. This compound is likely to exhibit interesting chemical properties, such as solubility in organic solvents and potential reactivity due to the presence of functional groups. Its molecular structure may confer specific pharmacokinetic and pharmacodynamic properties, making it a candidate for further investigation in medicinal chemistry. Additionally, the cyclopropyl group can introduce strain and unique steric effects, which may affect the compound's biological activity. Overall, 5-Cyclopropyl-3-[2-(trifluoromethoxy)phenyl]-4-isoxazolemethanol represents a complex molecule with potential applications in drug discovery and development.
Formula:C14H12F3NO3
InChI:InChI=1S/C14H12F3NO3/c15-14(16,17)20-11-4-2-1-3-9(11)12-10(7-19)13(21-18-12)8-5-6-8/h1-4,8,19H,5-7H2
InChI key:InChIKey=YJPRZVHHSVCUIU-UHFFFAOYSA-N
SMILES:C(O)C=1C(=NOC1C2CC2)C3=C(OC(F)(F)F)C=CC=C3
Synonyms:- 4-Isoxazolemethanol, 5-cyclopropyl-3-[2-(trifluoromethoxy)phenyl]-
- 5-Cyclopropyl-3-[2-(trifluoromethoxy)phenyl]-4-isoxazolemethanol
- (5-Cyclopropyl-3-(2-(trifluoromethoxy)phenyl)isoxazol-4-yl)methanol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.