CAS 94646-96-5

5-(5-nitrofuran-2-yl)-1,3,4-oxadiazole-2(3H)-thione

Description:

5-(5-Nitrofuran-2-yl)-1,3,4-oxadiazole-2(3H)-thione is a heterocyclic compound characterized by the presence of an oxadiazole ring, which is a five-membered ring containing two nitrogen atoms and three carbon atoms. The compound features a nitrofuran moiety, which contributes to its potential biological activity, particularly in antimicrobial and antitumor applications. The thione functional group (–S=) indicates the presence of sulfur, which can influence the compound's reactivity and stability. This substance is typically synthesized through specific organic reactions involving the appropriate precursors. Its properties may include moderate solubility in organic solvents, and it may exhibit fluorescence or other optical properties due to the presence of the nitrofuran group. The compound's structure suggests potential applications in pharmaceuticals, agrochemicals, or as a building block in organic synthesis. As with many heterocycles, its reactivity and interactions with biological systems can be of significant interest in medicinal chemistry.

Formula: C₆H₃N₃O₄S

InChI: InChI=1/C6H3N3O4S/c10-9(11)4-2-1-3(12-4)5-7-8-6(14)13-5/h1-2H,(H,8,14)

SMILES: c1cc(N(=O)=O)oc1c1nnc(o1)S

Synonyms:

• 1,3,4-Oxadiazole-2-Thiol, 5-(5-Nitro-2-Furanyl)-
• 5-(5-Nitro-2-furyl)-1,3,4-oxadiazole-2-thiol