CAS 946518-50-9

3,5-Dimethyl-1-piperazinepropanamine

Description:

3,5-Dimethyl-1-piperazinepropanamine is an organic compound characterized by its piperazine ring, which is a six-membered cyclic amine featuring two nitrogen atoms. This compound contains two methyl groups at the 3 and 5 positions of the piperazine, contributing to its unique steric and electronic properties. The propanamine moiety indicates the presence of a three-carbon chain with an amine functional group, which enhances its potential for hydrogen bonding and reactivity. Typically, compounds like this may exhibit basic properties due to the presence of the amine group, making them soluble in polar solvents. The structural features suggest potential applications in pharmaceuticals or as intermediates in organic synthesis. Additionally, the presence of multiple functional groups may influence its biological activity, making it a candidate for further research in medicinal chemistry. As with any chemical substance, safety data and handling precautions should be reviewed before use, given the potential for toxicity or reactivity.

Formula: C₉H₂₁N₃

InChI: InChI=1S/C9H21N3/c1-8-6-12(5-3-4-10)7-9(2)11-8/h8-9,11H,3-7,10H2,1-2H3

InChI key: InChIKey=DCMSEBJANHAWIS-UHFFFAOYSA-N

SMILES: C(CCN)N1CC(C)NC(C)C1

Synonyms:

• 1-(3-Aminopropyl)-3,5-dimethylpiperazine
• 1-Piperazinepropanamine, 3,5-dimethyl-
• 3,5-Dimethyl-1-piperazinepropanamine