
CAS 946518-61-2
:2-[5-Chloro-2-[[3-(4-methylpiperazin-1-yl)propyl]amino]pyrimidin-4-yl]benzo[b]thiophene-4-carboxamide N-cyclopropyl
Description:
The chemical substance known as "2-[5-Chloro-2-[[3-(4-methylpiperazin-1-yl)propyl]amino]pyrimidin-4-yl]benzo[b]thiophene-4-carboxamide N-cyclopropyl" with CAS number 946518-61-2 is a complex organic compound characterized by its multi-functional structure. It features a benzo[b]thiophene core, which is fused with a pyrimidine ring, and incorporates a chloro substituent that enhances its biological activity. The presence of a carboxamide group contributes to its potential as a pharmacological agent, while the cyclopropyl moiety may influence its binding affinity and selectivity towards biological targets. Additionally, the compound contains a piperazine derivative, which is often associated with improved solubility and bioavailability in medicinal chemistry. Overall, this compound is likely to exhibit significant interactions with biological systems, making it of interest in drug discovery and development, particularly in the context of targeting specific receptors or enzymes. Its precise characteristics, including solubility, stability, and reactivity, would depend on the specific conditions under which it is studied.
Formula:C24H29ClN6OS
InChI:InChI=1S/C24H29ClN6OS/c1-30-10-12-31(13-11-30)9-3-8-26-24-27-15-19(25)22(29-24)21-14-18-17(4-2-5-20(18)33-21)23(32)28-16-6-7-16/h2,4-5,14-16H,3,6-13H2,1H3,(H,28,32)(H,26,27,29)
InChI key:InChIKey=BNFAYJPQCPZQND-UHFFFAOYSA-N
SMILES:C(NC1CC1)(=O)C2=C3C(SC(=C3)C4=NC(NCCCN5CCN(C)CC5)=NC=C4Cl)=CC=C2
Synonyms:- 2-[5-Chloro-2-[[3-(4-methyl-1-piperazinyl)propyl]amino]-4-pyrimidinyl]-N-cyclopropylbenzo[b]thiophene-4-carboxamide
- Benzo[b]thiophene-4-carboxamide, 2-[5-chloro-2-[[3-(4-methyl-1-piperazinyl)propyl]amino]-4-pyrimidinyl]-N-cyclopropyl-
- 2-[5-Chloro-2-[[3-(4-methylpiperazin-1-yl)propyl]amino]pyrimidin-4-yl]benzo[b]thiophene-4-carboxamide N-cyclopropyl
- 2-[5-Chloro-2-[3-(4-methylpiperazin-1-yl)propylamino]pyrimidin-4-yl]-N-cyclopropyl-1-benzothiophene-4-carboxamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
LY2409881
CAS:LY2409881 is a selective IκB kinase β ( IKK2 ) inhibitor with an IC 50 of 30 nM.Formula:C24H29ClN6OSColor and Shape:SolidMolecular weight:485.05
