
CAS 946525-31-1
:1-Bromo-2-(chloromethyl)-4-iodobenzene
Description:
1-Bromo-2-(chloromethyl)-4-iodobenzene is an organic compound characterized by the presence of multiple halogen substituents on a benzene ring. This compound features a bromine atom at the first position, a chloromethyl group at the second position, and an iodine atom at the fourth position of the benzene ring. The presence of these halogens contributes to its reactivity, making it a useful intermediate in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. The compound is likely to exhibit polar characteristics due to the electronegative halogens, which can influence its solubility in various solvents. Additionally, the presence of multiple halogens can enhance its potential for electrophilic substitution reactions. Safety considerations are important when handling this compound, as halogenated compounds can pose health risks and environmental concerns. Proper storage and disposal methods should be followed to mitigate any hazards associated with its use. Overall, 1-Bromo-2-(chloromethyl)-4-iodobenzene is a versatile compound in synthetic organic chemistry.
Formula:C7H5BrClI
InChI:InChI=1S/C7H5BrClI/c8-7-2-1-6(10)3-5(7)4-9/h1-3H,4H2
InChI key:InChIKey=IPTYFZLHONGTGW-UHFFFAOYSA-N
SMILES:C(Cl)C1=C(Br)C=CC(I)=C1
Synonyms:- 2-Bromo-5-iodobenzyl chloride
- Benzene, 1-bromo-2-(chloromethyl)-4-iodo-
- 1-Bromo-2-(chloromethyl)-4-iodobenzene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.