CAS 946578-34-3

5-(Chloromethyl)-2-(difluoromethyl)pyridine

Description:

5-(Chloromethyl)-2-(difluoromethyl)pyridine is a chemical compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a chloromethyl group at the 5-position and a difluoromethyl group at the 2-position contributes to its reactivity and potential applications in organic synthesis and medicinal chemistry. This compound is typically a colorless to pale yellow liquid or solid, depending on its form and purity. It exhibits polar characteristics due to the electronegative chlorine and fluorine atoms, which can influence its solubility in various solvents. The difluoromethyl group enhances its lipophilicity and may affect its biological activity. As with many halogenated compounds, it is important to handle this substance with care due to potential toxicity and environmental concerns. Its unique structure makes it a valuable intermediate in the synthesis of pharmaceuticals and agrochemicals, where the introduction of halogen substituents can significantly alter the properties of the resulting compounds.

Formula: C₇H₆ClF₂N

InChI: InChI=1S/C7H6ClF2N/c8-3-5-1-2-6(7(9)10)11-4-5/h1-2,4,7H,3H2

InChI key: InChIKey=JBPXSGWUPDDVKC-UHFFFAOYSA-N

SMILES: C(F)(F)C1=CC=C(CCl)C=N1

Synonyms:

• Pyridine, 5-(chloromethyl)-2-(difluoromethyl)-
• 5-(Chloromethyl)-2-(difluoromethyl)pyridine