CAS 946594-91-8
:3-Amino-6-(trifluoromethyl)-2-pyridinecarboxamide
Description:
3-Amino-6-(trifluoromethyl)-2-pyridinecarboxamide is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. The presence of an amino group (-NH2) and a trifluoromethyl group (-CF3) at specific positions on the pyridine ring significantly influences its chemical properties and reactivity. This compound is typically a solid at room temperature and is soluble in polar solvents due to the presence of the carboxamide functional group, which enhances its hydrogen bonding capabilities. The trifluoromethyl group imparts unique electronic properties, making the compound potentially useful in medicinal chemistry and agrochemical applications. Its CAS number, 946594-91-8, allows for precise identification in chemical databases. Overall, this compound's structure suggests potential applications in drug development, particularly in targeting specific biological pathways due to its functional groups and aromatic nature.
Formula:C7H6F3N3O
InChI:InChI=1S/C7H6F3N3O/c8-7(9,10)4-2-1-3(11)5(13-4)6(12)14/h1-2H,11H2,(H2,12,14)
InChI key:InChIKey=REVXQVKVDSSRJX-UHFFFAOYSA-N
SMILES:C(N)(=O)C=1N=C(C(F)(F)F)C=CC1N
Synonyms:- 2-Pyridinecarboxamide, 3-amino-6-(trifluoromethyl)-
- 3-Amino-6-trifluoromethylpyridine-2-carboxamide
- 3-Amino-6-(trifluoromethyl)picolinamide
- 3-Amino-6-(trifluoromethyl)-2-pyridinecarboxamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.