CAS 946594-93-0
:4-Chloro-6-(trifluoromethyl)pyrido[3,2-d]pyrimidine
Description:
4-Chloro-6-(trifluoromethyl)pyrido[3,2-d]pyrimidine is a heterocyclic organic compound characterized by its fused pyridine and pyrimidine rings, which contribute to its unique chemical properties. The presence of a chloro group and a trifluoromethyl group enhances its reactivity and lipophilicity, making it of interest in medicinal chemistry and agrochemical applications. This compound typically exhibits a solid-state at room temperature and is likely to be sparingly soluble in water due to its aromatic structure and halogen substituents. Its molecular structure suggests potential for hydrogen bonding and interactions with biological targets, which may influence its pharmacological activity. Additionally, the trifluoromethyl group is known to increase metabolic stability and bioavailability in drug design. Safety data should be consulted for handling, as halogenated compounds can pose environmental and health risks. Overall, 4-Chloro-6-(trifluoromethyl)pyrido[3,2-d]pyrimidine represents a valuable scaffold for further research and development in various chemical applications.
Formula:C8H3ClF3N3
InChI:InChI=1S/C8H3ClF3N3/c9-7-6-4(13-3-14-7)1-2-5(15-6)8(10,11)12/h1-3H
InChI key:InChIKey=WPHCNXOZDINKFI-UHFFFAOYSA-N
SMILES:ClC=1C2=C(C=CC(C(F)(F)F)=N2)N=CN1
Synonyms:- 4-Chloro-6-(trifluoromethyl)pyrido[3,2-d]pyrimidine
- Pyrido[3,2-d]pyrimidine, 4-chloro-6-(trifluoromethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
