CAS 946598-39-6

5-(Morpholin-4-yl)pyrazine-2-carboxylic acid

Description:

5-(Morpholin-4-yl)pyrazine-2-carboxylic acid is a chemical compound characterized by its pyrazine core, which is a six-membered aromatic ring containing two nitrogen atoms. The presence of a carboxylic acid functional group (-COOH) at the 2-position contributes to its acidity and potential reactivity, while the morpholine moiety at the 5-position enhances its solubility and biological activity. This compound is typically a white to off-white solid and is soluble in polar solvents such as water and methanol. It may exhibit various biological activities, making it of interest in medicinal chemistry and drug development. The morpholine ring can also influence the compound's pharmacokinetic properties, such as permeability and metabolic stability. Overall, 5-(Morpholin-4-yl)pyrazine-2-carboxylic acid serves as a valuable scaffold in the synthesis of more complex molecules and may have applications in therapeutic contexts, particularly in the development of pharmaceuticals targeting specific biological pathways.

Formula: C₉H₁₁N₃O₃

InChI: InChI=1/C9H11N3O3/c13-9(14)7-5-11-8(6-10-7)12-1-3-15-4-2-12/h5-6H,1-4H2,(H,13,14)

SMILES: C1COCCN1c1cnc(cn1)C(=O)O

Synonyms:

• 2-Pyrazinecarboxylic Acid, 5-(4-Morpholinyl)-

5-Morpholinopyrazine-2-carboxylic acid

CAS: 946598-39-6

Formula: C₉H₁₁N₃O₃

Purity: 95%

Color and Shape: Solid

Molecular weight: 209.2019

Ref: IN-DA006TRH

5-Morpholinopyrazine-2-carboxylic acid

CAS: 946598-39-6

5-Morpholinopyrazine-2-carboxylic acid

Purity: 95%

Molecular weight: 209.2g/mol

Ref: 54-OR1044770

5-(4-Morpholinyl)-2-pyrazinecarboxylic acid

CAS: 946598-39-6

Versatile small molecule scaffold

Formula: C₉H₁₁N₃O₃

Purity: Min. 95%

Molecular weight: 209.2 g/mol

Ref: 3D-WMB59839