CymitQuimica logo

CAS 946617-97-6

:

Poly(oxy-1,2-ethanediyl), α-[2-[[(dodecylthio)thioxomethyl]thio]-2-methyl-1-oxopropyl]-ω-[2-[[(dodecylthio)thioxomethyl]thio]-2-methyl-1-oxopropoxy]-

Description:
The chemical substance known as Poly(oxy-1,2-ethanediyl), α-[2-[[(dodecylthio)thioxomethyl]thio]-2-methyl-1-oxopropyl]-ω-[2-[[(dodecylthio)thioxomethyl]thio]-2-methyl-1-oxopropoxy]- (CAS 946617-97-6) is a complex polymeric compound characterized by its amphiphilic nature, which arises from the presence of both hydrophilic poly(ethylene glycol) segments and hydrophobic dodecylthio groups. This structure contributes to its surfactant properties, making it useful in various applications such as emulsification, solubilization, and stabilization of formulations in pharmaceuticals and cosmetics. The presence of thioxomethyl groups enhances its reactivity and potential for functionalization, allowing for tailored interactions with other chemical species. Additionally, the polymer's molecular weight and degree of polymerization can influence its physical properties, such as viscosity and solubility in different solvents. Overall, this compound exemplifies the versatility of polymer chemistry in creating materials with specific functionalities for industrial and research applications.
Formula:(C2H4O)nC34H62O3S6
Synonyms:
  • Poly(oxy-1,2-ethanediyl), α-[2-[[(dodecylthio)thioxomethyl]thio]-2-methyl-1-oxopropyl]-ω-[2-[[(dodecylthio)thioxomethyl]thio]-2-methyl-1-oxopropoxy]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.