CAS 946655-79-4

1-(1-ethyl-1H-pyrazol-5-yl)ethanone

Description:

1-(1-ethyl-1H-pyrazol-5-yl)ethanone, with the CAS number 946655-79-4, is an organic compound characterized by its pyrazole ring structure, which is a five-membered ring containing two nitrogen atoms. This compound features an ethyl group attached to the pyrazole nitrogen and an ethanone functional group, indicating the presence of a carbonyl (C=O) group adjacent to the pyrazole moiety. The presence of the pyrazole ring imparts certain reactivity and stability characteristics, making it of interest in various chemical applications, including medicinal chemistry and agrochemicals. The compound is likely to exhibit moderate polarity due to the carbonyl group, influencing its solubility in organic solvents. Additionally, the presence of the ethyl group can affect its steric and electronic properties, potentially enhancing its biological activity. As with many pyrazole derivatives, it may exhibit interesting pharmacological properties, making it a subject of research in drug development. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.

Formula: C₇H₁₀N₂O

InChI: InChI=1/C7H10N2O/c1-3-9-7(6(2)10)4-5-8-9/h4-5H,3H2,1-2H3

SMILES: CCn1c(ccn1)C(=O)C

Synonyms:

• Ethanone, 1-(1-ethyl-1H-pyrazol-5-yl)-
• 1-(1-Ethyl-1H-pyrazol-5-yl)ethanone