CAS 94666-07-6
:5-[2-[[2-(2-Ethoxyphenoxy)ethyl]amino]propyl]-2-methoxybenzenesulfonamide
Description:
5-[2-[[2-(2-Ethoxyphenoxy)ethyl]amino]propyl]-2-methoxybenzenesulfonamide, with the CAS number 94666-07-6, is a chemical compound that belongs to the class of sulfonamides. This compound features a sulfonamide functional group, which is characterized by the presence of a sulfonyl group (–SO2) attached to an amine. Its structure includes a methoxy group and an ethoxyphenoxy moiety, contributing to its potential biological activity. The presence of the amino group suggests that it may exhibit properties related to amine chemistry, such as basicity and the ability to form hydrogen bonds. This compound may be of interest in medicinal chemistry due to its potential pharmacological properties, possibly acting as an inhibitor or modulator in biological systems. Additionally, the presence of multiple functional groups indicates that it could participate in various chemical reactions, making it a versatile compound for further research and development in drug design or other applications. However, specific biological activity and safety profiles would require further investigation through empirical studies.
Formula:C20H28N2O5S
InChI:InChI=1S/C20H28N2O5S/c1-4-26-17-7-5-6-8-18(17)27-12-11-22-15(2)13-16-9-10-19(25-3)20(14-16)28(21,23)24/h5-10,14-15,22H,4,11-13H2,1-3H3,(H2,21,23,24)
InChI key:InChIKey=DRHKJLXJIQTDTD-UHFFFAOYSA-N
SMILES:S(N)(=O)(=O)C1=C(OC)C=CC(CC(NCCOC2=C(OCC)C=CC=C2)C)=C1
Synonyms:- (?à)-Tamsulosin
- (±)-Tamsulosin
- 5-[2-[[2-(2-Ethoxyphenoxy)ethyl]amino]propyl]-2-methoxybenzenesulfonamide
- Benzenesulfonamide, 5-[2-[[2-(2-ethoxyphenoxy)ethyl]amino]propyl]-2-methoxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Racemic Tamsulosin
CAS:Racemic Tamsulosin is a biochemical.Formula:C20H28N2O5SColor and Shape:SolidMolecular weight:408.51
