CAS 946663-46-3

3-Methyl-4-[(tetrahydro-2-furanyl)methoxy]benzenamine

Description:

3-Methyl-4-[(tetrahydro-2-furanyl)methoxy]benzenamine, identified by its CAS number 946663-46-3, is an organic compound characterized by its aromatic amine structure. It features a methyl group and a methoxy group attached to a benzene ring, along with a tetrahydro-2-furanyl moiety, which contributes to its unique properties. This compound is likely to exhibit moderate polarity due to the presence of the methoxy and amine functional groups, influencing its solubility in various solvents. The tetrahydrofuran ring may impart some degree of stability and reactivity, making it of interest in synthetic organic chemistry. Additionally, the presence of the amine group suggests potential for hydrogen bonding, which can affect its physical properties such as boiling point and melting point. The compound may also exhibit biological activity, making it a candidate for pharmaceutical research. However, specific data regarding its toxicity, reactivity, and applications would require further investigation through experimental studies and literature review.

Formula: C₁₂H₁₇NO₂

InChI: InChI=1S/C12H17NO2/c1-9-7-10(13)4-5-12(9)15-8-11-3-2-6-14-11/h4-5,7,11H,2-3,6,8,13H2,1H3

InChI key: InChIKey=NDKKLADFIPZRHF-UHFFFAOYSA-N

SMILES: O(CC1CCCO1)C2=C(C)C=C(N)C=C2

Synonyms:

• Benzenamine, 3-methyl-4-[(tetrahydro-2-furanyl)methoxy]-
• 3-Methyl-4-[(tetrahydro-2-furanyl)methoxy]benzenamine