CymitQuimica logo

CAS 946663-64-5

:

3-Methyl-4-(3-methylphenoxy)benzenamine

Description:
3-Methyl-4-(3-methylphenoxy)benzenamine, identified by its CAS number 946663-64-5, is an organic compound characterized by its aromatic amine structure. It features a benzene ring substituted with both a methyl group and a phenoxy group, which contributes to its unique chemical properties. The presence of the amine functional group indicates that it can participate in hydrogen bonding, influencing its solubility and reactivity. This compound is likely to exhibit moderate polarity due to the combination of hydrophobic aromatic rings and the polar amine group. Its molecular structure suggests potential applications in various fields, including pharmaceuticals and materials science, where it may serve as an intermediate in the synthesis of more complex molecules. Additionally, the presence of multiple methyl groups can affect its physical properties, such as melting and boiling points, as well as its stability under different conditions. As with many organic compounds, safety and handling precautions should be observed, particularly due to the potential toxicity associated with amines.
Formula:C14H15NO
InChI:InChI=1S/C14H15NO/c1-10-4-3-5-13(8-10)16-14-7-6-12(15)9-11(14)2/h3-9H,15H2,1-2H3
InChI key:InChIKey=HMCGPEZUQWSKPY-UHFFFAOYSA-N
SMILES:O(C1=C(C)C=C(N)C=C1)C2=CC(C)=CC=C2
Synonyms:
  • Benzenamine, 3-methyl-4-(3-methylphenoxy)-
  • 3-Methyl-4-(3-methylphenoxy)benzenamine
  • 3-Methyl-4-(3-methylphenoxy)aniline
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.