CAS 946663-82-7

4-(Cyclopentylmethoxy)-3-fluorobenzenamine

Description:

4-(Cyclopentylmethoxy)-3-fluorobenzenamine, identified by its CAS number 946663-82-7, is an organic compound characterized by its aromatic structure, which includes a fluorine atom and an amine group attached to a benzene ring. The presence of the cyclopentylmethoxy group contributes to its unique properties, influencing its solubility and reactivity. This compound is likely to exhibit moderate polarity due to the combination of the hydrophobic cyclopentyl group and the polar amine and methoxy functionalities. It may participate in hydrogen bonding due to the amine group, which can affect its interactions in biological systems or chemical reactions. The fluorine substitution can enhance the compound's lipophilicity and may also influence its electronic properties, potentially making it a candidate for various applications in medicinal chemistry or materials science. As with many organic compounds, its stability, reactivity, and potential applications would depend on the specific conditions under which it is used, including temperature, solvent, and the presence of other reactive species.

Formula: C₁₂H₁₆FNO

InChI: InChI=1S/C12H16FNO/c13-11-7-10(14)5-6-12(11)15-8-9-3-1-2-4-9/h5-7,9H,1-4,8,14H2

InChI key: InChIKey=XXONWNHQSNEALI-UHFFFAOYSA-N

SMILES: O(CC1CCCC1)C2=C(F)C=C(N)C=C2

Synonyms:

• Benzenamine, 4-(cyclopentylmethoxy)-3-fluoro-
• 4-(Cyclopentylmethoxy)-3-fluorobenzenamine