CymitQuimica logo

CAS 946664-06-8

:

4-(4-chlorophenoxy)-3-fluoro-aniline

Description:
4-(4-Chlorophenoxy)-3-fluoro-aniline, with the CAS number 946664-06-8, is an organic compound characterized by its aromatic structure, which includes a fluorine atom and a chlorophenoxy group. This compound features an aniline moiety, indicating the presence of an amino group (-NH2) attached to a benzene ring, which is further substituted with a chlorophenoxy group and a fluorine atom. The presence of these substituents can influence its chemical reactivity, solubility, and potential applications in various fields, including pharmaceuticals and agrochemicals. Typically, compounds like this may exhibit moderate to high lipophilicity due to their aromatic nature, which can affect their bioavailability and interaction with biological systems. Additionally, the chlorine and fluorine substituents can enhance the compound's stability and alter its electronic properties, making it of interest in medicinal chemistry for the development of new therapeutic agents. Safety and handling precautions should be observed, as with many organic compounds, due to potential toxicity or environmental impact.
Formula:C12H9ClFNO
InChI:InChI=1/C12H9ClFNO/c13-8-1-4-10(5-2-8)16-12-6-3-9(15)7-11(12)14/h1-7H,15H2
SMILES:c1cc(ccc1Cl)Oc1ccc(cc1F)N
Synonyms:
  • 4-(4-Chlorophenoxy)-3-fluoroaniline
  • Benzenamine, 4-(4-Chlorophenoxy)-3-Fluoro-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.