CymitQuimica logo

CAS 946664-84-2

:

5-Bromo-2-(3-methylbutoxy)benzenamine

Description:
5-Bromo-2-(3-methylbutoxy)benzenamine is an organic compound characterized by its aromatic structure, which includes a bromine substituent and an amine functional group. The presence of the bromine atom introduces both reactivity and potential for further substitution reactions, while the amine group can participate in hydrogen bonding and nucleophilic reactions. The 3-methylbutoxy group contributes to the compound's hydrophobic characteristics, influencing its solubility and interaction with biological systems. This compound may exhibit properties such as moderate to high lipophilicity due to the alkyl ether moiety, which can affect its bioavailability and pharmacokinetics if considered for pharmaceutical applications. Additionally, the structural features suggest potential applications in organic synthesis, materials science, or as a building block in the development of more complex molecules. Safety and handling considerations should be taken into account, as with any chemical substance, particularly regarding its reactivity and potential toxicity.
Formula:C11H16BrNO
InChI:InChI=1S/C11H16BrNO/c1-8(2)5-6-14-11-4-3-9(12)7-10(11)13/h3-4,7-8H,5-6,13H2,1-2H3
InChI key:InChIKey=XTUGCDAAVVKTEI-UHFFFAOYSA-N
SMILES:O(CCC(C)C)C1=C(N)C=C(Br)C=C1
Synonyms:
  • Benzenamine, 5-bromo-2-(3-methylbutoxy)-
  • 5-Bromo-2-(3-methylbutoxy)benzenamine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.