CymitQuimica logo

CAS 946681-02-3

:

3-(2,3-Dimethylphenoxy)piperidine

Description:
3-(2,3-Dimethylphenoxy)piperidine is an organic compound characterized by its piperidine ring, which is a six-membered saturated nitrogen-containing heterocycle. The compound features a phenoxy group, specifically a 2,3-dimethyl-substituted phenyl moiety, which contributes to its unique chemical properties. This substitution pattern can influence the compound's solubility, reactivity, and biological activity. The presence of the piperidine ring suggests potential applications in medicinal chemistry, as piperidine derivatives are often explored for their pharmacological properties. The compound's molecular structure may exhibit specific interactions with biological targets, making it of interest in drug development. Additionally, the presence of methyl groups on the aromatic ring can enhance lipophilicity, potentially affecting the compound's absorption and distribution in biological systems. Overall, 3-(2,3-Dimethylphenoxy)piperidine is a compound of interest in various fields, including organic synthesis and pharmaceutical research, due to its structural characteristics and potential applications.
Formula:C13H19NO
InChI:InChI=1S/C13H19NO/c1-10-5-3-7-13(11(10)2)15-12-6-4-8-14-9-12/h3,5,7,12,14H,4,6,8-9H2,1-2H3
InChI key:InChIKey=ASENSQCMNLUDAX-UHFFFAOYSA-N
SMILES:O(C1=C(C)C(C)=CC=C1)C2CCCNC2
Synonyms:
  • Piperidine, 3-(2,3-dimethylphenoxy)-
  • 3-(2,3-Dimethylphenoxy)piperidine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.