
CAS 946681-05-6
:3-(2,5-Dimethylphenoxy)piperidine
Description:
3-(2,5-Dimethylphenoxy)piperidine is an organic compound characterized by its piperidine ring, which is a six-membered saturated nitrogen-containing heterocycle. The presence of the 2,5-dimethylphenoxy group indicates that the compound has a phenolic structure with two methyl substituents on the aromatic ring, contributing to its hydrophobic characteristics. This compound is typically used in medicinal chemistry and may exhibit biological activity due to its structural features, which can influence its interaction with biological targets. The piperidine moiety often imparts properties such as basicity and the ability to form hydrogen bonds, which can enhance solubility in various solvents. Additionally, the presence of the dimethylphenoxy group may affect the compound's lipophilicity and overall pharmacokinetic profile. As with many organic compounds, its stability, reactivity, and potential applications can be influenced by environmental factors such as temperature and pH. Safety data and handling precautions should be considered when working with this substance in a laboratory setting.
Formula:C13H19NO
InChI:InChI=1S/C13H19NO/c1-10-5-6-11(2)13(8-10)15-12-4-3-7-14-9-12/h5-6,8,12,14H,3-4,7,9H2,1-2H3
InChI key:InChIKey=CRUXPJDCOAFMLS-UHFFFAOYSA-N
SMILES:O(C1=C(C)C=CC(C)=C1)C2CCCNC2
Synonyms:- 3-(2,5-Dimethylphenoxy)piperidine
- Piperidine, 3-(2,5-dimethylphenoxy)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.