CAS 946681-09-0

3-(3-Bromophenoxy)piperidine

Description:

3-(3-Bromophenoxy)piperidine is an organic compound characterized by its piperidine ring, which is a six-membered nitrogen-containing heterocycle. The structure features a bromophenoxy group, where a bromine atom is attached to a phenyl ring that is further connected to a piperidine via an ether linkage. This compound is typically classified as an aryl ether and may exhibit properties such as moderate solubility in organic solvents due to the presence of both hydrophobic aromatic and hydrophilic piperidine components. The bromine substituent can influence the compound's reactivity and biological activity, potentially enhancing its lipophilicity and affecting its interaction with biological targets. 3-(3-Bromophenoxy)piperidine may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, as piperidine derivatives are often associated with various therapeutic effects. Safety and handling considerations should be observed, as with many halogenated compounds, due to potential toxicity and environmental impact.

Formula: C₁₁H₁₄NOBr

InChI: InChI=1S/C11H14BrNO/c12-9-3-1-4-10(7-9)14-11-5-2-6-13-8-11/h1,3-4,7,11,13H,2,5-6,8H2

SMILES: c1cc(cc(c1)OC1CCCNC1)Br