
CAS 946681-18-1
:3-(4-Phenoxyphenoxy)piperidine
Description:
3-(4-Phenoxyphenoxy)piperidine, identified by its CAS number 946681-18-1, is a chemical compound characterized by its piperidine core, which is a six-membered ring containing one nitrogen atom. This compound features two phenoxy groups, which are aromatic structures containing an ether linkage (-O-) to a phenyl group. The presence of these phenoxy substituents contributes to its potential for various biological activities, as they can influence the compound's lipophilicity and ability to interact with biological targets. The molecular structure suggests that it may exhibit properties relevant to medicinal chemistry, possibly acting as a ligand for certain receptors or enzymes. Additionally, the compound's solubility, stability, and reactivity can be influenced by the substituents on the piperidine ring and the phenoxy groups. Overall, 3-(4-Phenoxyphenoxy)piperidine is of interest in research contexts, particularly in the development of pharmaceuticals or agrochemicals, although specific biological activities and applications would require further investigation.
Formula:C17H19NO2
InChI:InChI=1S/C17H19NO2/c1-2-5-14(6-3-1)19-15-8-10-16(11-9-15)20-17-7-4-12-18-13-17/h1-3,5-6,8-11,17-18H,4,7,12-13H2
InChI key:InChIKey=JLOHZNPPAVOVTQ-UHFFFAOYSA-N
SMILES:O(C1=CC=C(OC2CCCNC2)C=C1)C3=CC=CC=C3
Synonyms:- Piperidine, 3-(4-phenoxyphenoxy)-
- 3-(4-Phenoxyphenoxy)piperidine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.