
CAS 946681-27-2
:3-(1-Naphthalenyloxy)piperidine
Description:
3-(1-Naphthalenyloxy)piperidine, identified by its CAS number 946681-27-2, is a chemical compound characterized by its unique structure that combines a piperidine ring with a naphthalenyl ether moiety. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential biological activity. The presence of the naphthalene group may impart hydrophobic characteristics, influencing its solubility and interaction with biological membranes. Additionally, the piperidine ring can participate in hydrogen bonding and may serve as a basic site due to the nitrogen atom. This compound is of interest in medicinal chemistry, particularly for its potential applications in drug development, as it may interact with various biological targets. Its synthesis and characterization involve standard organic chemistry techniques, and it may be studied for its pharmacological properties, including effects on neurotransmitter systems. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C15H17NO
InChI:InChI=1S/C15H17NO/c1-2-8-14-12(5-1)6-3-9-15(14)17-13-7-4-10-16-11-13/h1-3,5-6,8-9,13,16H,4,7,10-11H2
InChI key:InChIKey=ZKHVEMXTPDLCNY-UHFFFAOYSA-N
SMILES:O(C=1C2=C(C=CC1)C=CC=C2)C3CCCNC3
Synonyms:- 3-(1-Naphthalenyloxy)piperidine
- Piperidine, 3-(1-naphthalenyloxy)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.