CAS 946681-81-8

2-[(2,2-Dimethyl-1-oxopropyl)amino]-N-methoxy-N-methyl-4-pyridinecarboxamide

Description:

2-[(2,2-Dimethyl-1-oxopropyl)amino]-N-methoxy-N-methyl-4-pyridinecarboxamide, with the CAS number 946681-81-8, is a chemical compound characterized by its complex structure, which includes a pyridine ring and various functional groups such as an amide and methoxy groups. This compound is typically classified as a small organic molecule and may exhibit properties such as solubility in organic solvents, moderate polarity, and potential biological activity due to its amine and carbonyl functionalities. The presence of the pyridine moiety suggests possible interactions with biological targets, making it of interest in medicinal chemistry. Its specific characteristics, including melting point, boiling point, and reactivity, would depend on the molecular interactions and the environment in which it is studied. As with many organic compounds, safety data and handling precautions are essential, particularly regarding its potential toxicity and environmental impact. Further studies would be necessary to fully elucidate its properties and applications in various fields, including pharmaceuticals and agrochemicals.

Formula: C₁₃H₁₉N₃O₃

InChI: InChI=1S/C13H19N3O3/c1-13(2,3)12(18)15-10-8-9(6-7-14-10)11(17)16(4)19-5/h6-8H,1-5H3,(H,14,15,18)

InChI key: InChIKey=ZECTXKVADDIPOY-UHFFFAOYSA-N

SMILES: C(N(OC)C)(=O)C=1C=C(NC(C(C)(C)C)=O)N=CC1

Synonyms:

• 4-Pyridinecarboxamide, 2-[(2,2-dimethyl-1-oxopropyl)amino]-N-methoxy-N-methyl-
• 2-[(2,2-Dimethyl-1-oxopropyl)amino]-N-methoxy-N-methyl-4-pyridinecarboxamide