CymitQuimica logo

CAS 946681-95-4

:

3-(4-Bromo-2-fluorophenoxy)pyrrolidine

Description:
3-(4-Bromo-2-fluorophenoxy)pyrrolidine is a chemical compound characterized by its unique structure, which includes a pyrrolidine ring and a phenoxy group substituted with bromine and fluorine atoms. The presence of the bromine and fluorine substituents on the phenyl ring contributes to its potential reactivity and biological activity, making it of interest in medicinal chemistry and drug development. The compound is likely to exhibit specific physical properties such as solubility in organic solvents, and its molecular structure may influence its interactions with biological targets. Additionally, the presence of halogens can enhance lipophilicity, affecting the compound's pharmacokinetics. As with many organic compounds, safety and handling precautions are essential due to potential toxicity associated with halogenated compounds. Overall, 3-(4-Bromo-2-fluorophenoxy)pyrrolidine represents a class of compounds that may have applications in various fields, including pharmaceuticals and agrochemicals, warranting further investigation into its properties and potential uses.
Formula:C10H11BrFNO
InChI:InChI=1S/C10H11BrFNO/c11-7-1-2-10(9(12)5-7)14-8-3-4-13-6-8/h1-2,5,8,13H,3-4,6H2
InChI key:InChIKey=ROCHIWHKQDJXLQ-UHFFFAOYSA-N
SMILES:O(C1=C(F)C=C(Br)C=C1)C2CCNC2
Synonyms:
  • 3-(4-Bromo-2-fluorophenoxy)pyrrolidine
  • Pyrrolidine, 3-(4-bromo-2-fluorophenoxy)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.