
CAS 946681-98-7
:3-(2,4-Dichloro-3,5-dimethylphenoxy)pyrrolidine
Description:
3-(2,4-Dichloro-3,5-dimethylphenoxy)pyrrolidine, identified by its CAS number 946681-98-7, is a chemical compound characterized by its unique structural features. It consists of a pyrrolidine ring, which is a five-membered nitrogen-containing heterocycle, linked to a phenoxy group that bears two chlorine substituents and two methyl groups on the aromatic ring. This compound is typically classified as an organic molecule and may exhibit properties such as moderate solubility in organic solvents, depending on the specific functional groups present. The presence of chlorine atoms often imparts increased lipophilicity and can influence the compound's biological activity, potentially making it relevant in pharmaceutical applications. Additionally, the methyl groups can affect steric hindrance and electronic properties, which may play a role in the compound's reactivity and interactions with biological targets. Overall, the characteristics of this compound suggest potential utility in various chemical and biological contexts, although specific applications would depend on further research and analysis.
Formula:C12H15Cl2NO
InChI:InChI=1S/C12H15Cl2NO/c1-7-5-10(12(14)8(2)11(7)13)16-9-3-4-15-6-9/h5,9,15H,3-4,6H2,1-2H3
InChI key:InChIKey=JVLXGRRAAAWLKM-UHFFFAOYSA-N
SMILES:O(C1=C(Cl)C(C)=C(Cl)C(C)=C1)C2CCNC2
Synonyms:- 3-(2,4-Dichloro-3,5-dimethylphenoxy)pyrrolidine
- Pyrrolidine, 3-(2,4-dichloro-3,5-dimethylphenoxy)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.