CymitQuimica logo

CAS 946682-10-6

:

3-[2-(3-Fluorophenoxy)ethyl]piperidine

Description:
3-[2-(3-Fluorophenoxy)ethyl]piperidine, with the CAS number 946682-10-6, is a chemical compound characterized by its piperidine core structure, which is a six-membered ring containing one nitrogen atom. This compound features a 3-fluorophenoxy group attached to a 2-ethyl chain, contributing to its unique properties. The presence of the fluorine atom in the phenoxy group can influence the compound's lipophilicity and biological activity, potentially enhancing its interaction with biological targets. The piperidine moiety is known for its role in various pharmacological applications, often serving as a scaffold in drug design. This compound may exhibit properties such as moderate solubility in organic solvents and potential activity as a ligand for neurotransmitter receptors or other biological targets. Its specific characteristics, including melting point, boiling point, and reactivity, would typically be determined through experimental methods or detailed computational studies. Overall, 3-[2-(3-Fluorophenoxy)ethyl]piperidine represents a compound of interest in medicinal chemistry and pharmacology.
Formula:C13H18FNO
InChI:InChI=1S/C13H18FNO/c14-12-4-1-5-13(9-12)16-8-6-11-3-2-7-15-10-11/h1,4-5,9,11,15H,2-3,6-8,10H2
InChI key:InChIKey=RAAMEPKFJUMRSF-UHFFFAOYSA-N
SMILES:O(CCC1CCCNC1)C2=CC(F)=CC=C2
Synonyms:
  • 3-[2-(3-Fluorophenoxy)ethyl]piperidine
  • Piperidine, 3-[2-(3-fluorophenoxy)ethyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.