CymitQuimica logo

CAS 946682-23-1

:

3-Chloro-2-[2-(diethylamino)ethoxy]benzenamine

Description:
3-Chloro-2-[2-(diethylamino)ethoxy]benzenamine is an organic compound characterized by its aromatic structure, which includes a chloro substituent and an ether functional group. The presence of the diethylamino group indicates that it has basic properties, making it potentially useful in various chemical reactions and applications, particularly in medicinal chemistry. The compound's molecular structure suggests it may exhibit moderate lipophilicity due to the ethyl groups, which can influence its solubility and permeability in biological systems. Additionally, the chloro group can participate in nucleophilic substitution reactions, enhancing its reactivity. This compound may be of interest in the development of pharmaceuticals or agrochemicals, given its functional groups that can interact with biological targets. Safety and handling precautions should be observed, as with many organic compounds, due to potential toxicity or reactivity. Overall, 3-Chloro-2-[2-(diethylamino)ethoxy]benzenamine presents a unique combination of functional groups that could be leveraged in various chemical applications.
Formula:C12H19ClN2O
InChI:InChI=1S/C12H19ClN2O/c1-3-15(4-2)8-9-16-12-10(13)6-5-7-11(12)14/h5-7H,3-4,8-9,14H2,1-2H3
InChI key:InChIKey=SPCFJXBDMYAHLL-UHFFFAOYSA-N
SMILES:O(CCN(CC)CC)C1=C(Cl)C=CC=C1N
Synonyms:
  • 3-Chloro-2-[2-(diethylamino)ethoxy]benzenamine
  • Benzenamine, 3-chloro-2-[2-(diethylamino)ethoxy]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.