CymitQuimica logo

CAS 946682-52-6

:

5-Chloro-2-(2-methoxyphenoxy)benzenamine

Description:
5-Chloro-2-(2-methoxyphenoxy)benzenamine, with the CAS number 946682-52-6, is an organic compound characterized by its aromatic structure, which includes a chloro substituent and an amine group. This compound features a chloro group at the 5-position of a benzene ring, while a methoxyphenoxy group is attached at the 2-position. The presence of the amine functional group suggests potential for hydrogen bonding, influencing its solubility and reactivity. Typically, compounds of this nature may exhibit biological activity, making them of interest in pharmaceutical research. The methoxy group can enhance lipophilicity, potentially affecting the compound's pharmacokinetics. Additionally, the chlorine atom may impart unique electronic properties, influencing the compound's reactivity and interactions with other molecules. Overall, 5-Chloro-2-(2-methoxyphenoxy)benzenamine is a complex organic molecule with potential applications in medicinal chemistry, though specific properties such as melting point, boiling point, and solubility would require empirical data for precise characterization.
Formula:C13H12ClNO2
InChI:InChI=1S/C13H12ClNO2/c1-16-12-4-2-3-5-13(12)17-11-7-6-9(14)8-10(11)15/h2-8H,15H2,1H3
InChI key:InChIKey=GHKPLKQAESHAKR-UHFFFAOYSA-N
SMILES:O(C1=C(OC)C=CC=C1)C2=C(N)C=C(Cl)C=C2
Synonyms:
  • 5-Chloro-2-(2-methoxyphenoxy)benzenamine
  • Benzenamine, 5-chloro-2-(2-methoxyphenoxy)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.