CAS 946682-58-2

5-Chloro-2-(4-chloro-3,5-dimethylphenoxy)benzenamine

Description:

5-Chloro-2-(4-chloro-3,5-dimethylphenoxy)benzenamine, with the CAS number 946682-58-2, is an organic compound characterized by its complex aromatic structure. It features a benzenamine core, which is an amine derivative of benzene, substituted with a chloro group and a phenoxy moiety. The presence of multiple chlorine and methyl groups contributes to its unique chemical properties, including potential reactivity and solubility characteristics. This compound may exhibit biological activity, making it of interest in pharmaceutical research or agrochemical applications. Its molecular structure suggests that it could participate in various chemical reactions, such as nucleophilic substitutions or electrophilic aromatic substitutions, depending on the conditions. Additionally, the presence of halogen atoms often influences the compound's stability and interaction with other molecules. Safety and handling precautions should be observed due to the potential toxicity associated with chlorinated compounds. Overall, 5-Chloro-2-(4-chloro-3,5-dimethylphenoxy)benzenamine represents a significant compound for further study in both synthetic and applied chemistry contexts.

Formula: C₁₄H₁₃Cl₂NO

InChI: InChI=1S/C14H13Cl2NO/c1-8-5-11(6-9(2)14(8)16)18-13-4-3-10(15)7-12(13)17/h3-7H,17H2,1-2H3

InChI key: InChIKey=MGBFXRZKNPFFJT-UHFFFAOYSA-N

SMILES: O(C1=C(N)C=C(Cl)C=C1)C2=CC(C)=C(Cl)C(C)=C2

Synonyms:

• 5-Chloro-2-(4-chloro-3,5-dimethylphenoxy)benzenamine
• Benzenamine, 5-chloro-2-(4-chloro-3,5-dimethylphenoxy)-