
CAS 946682-88-8
:2-(2-Fluorophenoxy)-5-methylbenzenamine
Description:
2-(2-Fluorophenoxy)-5-methylbenzenamine, identified by its CAS number 946682-88-8, is an organic compound characterized by its aromatic structure, which includes a fluorophenyl group and an amine functional group. This compound features a fluorine atom substituted on a phenyl ring, enhancing its reactivity and potential applications in medicinal chemistry. The presence of the methyl group on the benzene ring contributes to its hydrophobic characteristics, influencing its solubility and interaction with biological systems. The amine group can participate in hydrogen bonding, making it a potential candidate for various chemical reactions and applications, including as a building block in drug synthesis or as a ligand in coordination chemistry. Its specific physical properties, such as melting point, boiling point, and solubility, would typically be determined through experimental methods. Overall, the unique combination of functional groups in 2-(2-Fluorophenoxy)-5-methylbenzenamine suggests potential utility in pharmaceuticals and materials science, warranting further investigation into its chemical behavior and applications.
Formula:C13H12FNO
InChI:InChI=1S/C13H12FNO/c1-9-6-7-13(11(15)8-9)16-12-5-3-2-4-10(12)14/h2-8H,15H2,1H3
InChI key:InChIKey=JSPLEJOLSIXIDP-UHFFFAOYSA-N
SMILES:O(C1=C(N)C=C(C)C=C1)C2=C(F)C=CC=C2
Synonyms:- Benzenamine, 2-(2-fluorophenoxy)-5-methyl-
- 2-(2-Fluorophenoxy)-5-methylbenzenamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.