
CAS 946683-79-0
:5-Fluoro-2-[(tetrahydro-2H-pyran-2-yl)methoxy]benzenamine
Description:
5-Fluoro-2-[(tetrahydro-2H-pyran-2-yl)methoxy]benzenamine is a chemical compound characterized by its unique structure, which includes a fluorine atom, a methoxy group, and an amine functional group. The presence of the fluorine atom typically enhances the compound's lipophilicity and metabolic stability, making it of interest in medicinal chemistry. The tetrahydro-2H-pyran moiety contributes to the compound's overall three-dimensional shape, potentially influencing its biological activity and interactions with target proteins. This compound may exhibit properties such as solubility in organic solvents and moderate polarity due to the combination of hydrophobic and hydrophilic groups. Its amine functionality can participate in hydrogen bonding, which may affect its reactivity and solubility in aqueous environments. Overall, the structural features of 5-Fluoro-2-[(tetrahydro-2H-pyran-2-yl)methoxy]benzenamine suggest potential applications in pharmaceuticals, particularly in the development of therapeutic agents targeting specific biological pathways.
Formula:C12H16FNO2
InChI:InChI=1S/C12H16FNO2/c13-9-4-5-12(11(14)7-9)16-8-10-3-1-2-6-15-10/h4-5,7,10H,1-3,6,8,14H2
InChI key:InChIKey=ZOAQUIWZZYQJRO-UHFFFAOYSA-N
SMILES:O(CC1CCCCO1)C2=C(N)C=C(F)C=C2
Synonyms:- 5-Fluoro-2-[(tetrahydro-2H-pyran-2-yl)methoxy]benzenamine
- Benzenamine, 5-fluoro-2-[(tetrahydro-2H-pyran-2-yl)methoxy]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.