CymitQuimica logo

CAS 946683-82-5

:

5-Fluoro-2-(2-fluorophenoxy)benzenamine

Description:
5-Fluoro-2-(2-fluorophenoxy)benzenamine, with the CAS number 946683-82-5, is an organic compound characterized by its aromatic amine structure. It features a fluorinated benzene ring, which enhances its chemical reactivity and potential biological activity. The presence of the fluorine atoms contributes to its lipophilicity, potentially affecting its solubility and permeability in biological systems. This compound is likely to exhibit properties typical of aromatic amines, such as being a weak base due to the amino group, which can participate in hydrogen bonding. Additionally, the substitution pattern of the fluorine atoms can influence its electronic properties, making it of interest in medicinal chemistry and drug design. The compound may also exhibit specific interactions with biological targets, which could be relevant in the development of pharmaceuticals. Safety and handling considerations are important, as many fluorinated compounds can have unique toxicological profiles. Overall, 5-Fluoro-2-(2-fluorophenoxy)benzenamine represents a class of compounds that are valuable in research and potential therapeutic applications.
Formula:C12H9F2NO
InChI:InChI=1S/C12H9F2NO/c13-8-5-6-12(10(15)7-8)16-11-4-2-1-3-9(11)14/h1-7H,15H2
InChI key:InChIKey=AXILGPDCFFAUQQ-UHFFFAOYSA-N
SMILES:O(C1=C(N)C=C(F)C=C1)C2=C(F)C=CC=C2
Synonyms:
  • Benzenamine, 5-fluoro-2-(2-fluorophenoxy)-
  • 5-Fluoro-2-(2-fluorophenoxy)benzenamine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.