CAS 946689-96-9

N-(4-amino-3-methylphenyl)propanamide

Description:

N-(4-amino-3-methylphenyl)propanamide, also known by its CAS number 946689-96-9, is an organic compound characterized by its amide functional group attached to a substituted aniline structure. This compound features a propanamide backbone, which contributes to its solubility in polar solvents. The presence of the amino group (-NH2) and the methyl group (-CH3) on the aromatic ring influences its reactivity and potential biological activity. Typically, compounds of this nature may exhibit properties such as moderate to high melting points and varying degrees of solubility in water and organic solvents, depending on the specific substituents. The compound may also participate in hydrogen bonding due to the amide and amino groups, which can affect its interactions in biological systems. Additionally, it may serve as a precursor or intermediate in the synthesis of pharmaceuticals or agrochemicals, highlighting its relevance in medicinal chemistry and material science. As with many organic compounds, safety data should be consulted for handling and usage guidelines.

Formula: C₁₀H₁₄N₂O

InChI: InChI=1/C10H14N2O/c1-3-10(13)12-8-4-5-9(11)7(2)6-8/h4-6H,3,11H2,1-2H3,(H,12,13)

SMILES: CCC(=O)Nc1ccc(c(C)c1)N