CAS 946690-30-8

N-(3-amino-4-methyl-phenyl)-2-methyl-propanamide

Description:

N-(3-amino-4-methyl-phenyl)-2-methyl-propanamide, also known by its CAS number 946690-30-8, is an organic compound characterized by its amide functional group, which is indicative of its potential as a building block in pharmaceuticals and organic synthesis. This compound features a phenyl ring substituted with an amino group and a methyl group, contributing to its unique chemical properties. The presence of the amine group suggests it may participate in hydrogen bonding, influencing its solubility and reactivity. The branched alkyl chain (2-methyl-propanamide) enhances its steric properties, which can affect its interaction with biological targets. Typically, compounds like this may exhibit moderate to high polarity, affecting their behavior in various solvents. Additionally, the structural features may impart specific biological activities, making it of interest in medicinal chemistry. Overall, the characteristics of this compound suggest potential applications in drug development and other areas of chemical research, although specific biological or physical properties would require empirical investigation.

Formula: C₁₁H₁₆N₂O

InChI: InChI=1/C11H16N2O/c1-7(2)11(14)13-9-5-4-8(3)10(12)6-9/h4-7H,12H2,1-3H3,(H,13,14)

SMILES: CC(C)C(=Nc1ccc(C)c(c1)N)O

N-(3-Amino-4-methylphenyl)-2-methylpropanamide

CAS: 946690-30-8

Versatile small molecule scaffold

Formula: C₁₁H₁₆N₂O

Purity: Min. 95%

Molecular weight: 192.26 g/mol

Ref: 3D-WMB69030