CymitQuimica logo

CAS 946691-01-6

:

5-amino-2-chloro-N,N-dimethylbenzamide

Description:
5-Amino-2-chloro-N,N-dimethylbenzamide is an organic compound characterized by the presence of an amine group, a chloro substituent, and a dimethylamide functional group attached to a benzene ring. The molecular structure features a benzamide backbone, where the amine group is positioned at the 5th carbon and a chlorine atom at the 2nd carbon of the aromatic ring. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the amine and amide functionalities. Its chemical properties are influenced by the electron-withdrawing effect of the chlorine atom, which can affect reactivity and stability. The compound may be of interest in pharmaceutical research or as an intermediate in organic synthesis due to its functional groups, which can participate in various chemical reactions. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C9H11ClN2O
InChI:InChI=1/C9H11ClN2O/c1-12(2)9(13)7-5-6(11)3-4-8(7)10/h3-5H,11H2,1-2H3
SMILES:CN(C)C(=O)c1cc(ccc1Cl)N
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.