CAS 946692-39-3

2-(chloromethyl)-6,8-dimethyl-1H-quinolin-4-one

Description:

2-(Chloromethyl)-6,8-dimethyl-1H-quinolin-4-one is a chemical compound characterized by its quinoline core, which is a bicyclic structure containing a benzene ring fused to a pyridine ring. This compound features a chloromethyl group (-CH2Cl) at the 2-position and two methyl groups (-CH3) at the 6 and 8 positions of the quinoline ring, contributing to its unique reactivity and properties. The presence of the chloromethyl group makes it a potential electrophile, which can participate in various chemical reactions, including nucleophilic substitutions. The dimethyl substitutions enhance its lipophilicity, potentially influencing its biological activity and solubility in organic solvents. This compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its molecular structure allows for various synthetic modifications, which can be explored for developing derivatives with enhanced activity or specificity. As with many quinoline derivatives, it may also show potential as an antimicrobial or anticancer agent, although specific biological activities would require further investigation.

Formula: C₁₂H₁₂ClNO

InChI: InChI=1/C12H12ClNO/c1-7-3-8(2)12-10(4-7)11(15)5-9(6-13)14-12/h3-5H,6H2,1-2H3,(H,14,15)

SMILES: Cc1cc(C)c2c(c1)c(=O)cc(CCl)[nH]2