CAS 946698-83-5

4-(2-Methoxy-4-methylphenoxy)-3-methylbenzenamine

Description:

4-(2-Methoxy-4-methylphenoxy)-3-methylbenzenamine, identified by its CAS number 946698-83-5, is an organic compound characterized by its complex aromatic structure. It features a primary amine group (-NH2) attached to a benzene ring, which is further substituted with a methoxy group (-OCH3) and a methyl group (-CH3) on adjacent aromatic rings. This compound exhibits properties typical of aromatic amines, including potential applications in organic synthesis and as intermediates in the production of dyes, pharmaceuticals, or agrochemicals. The presence of the methoxy and methyl substituents can influence its solubility, reactivity, and overall chemical behavior, making it of interest in various chemical research fields. Additionally, the compound's structure suggests it may participate in hydrogen bonding and other intermolecular interactions, which can affect its physical properties such as melting point and boiling point. As with many aromatic amines, safety considerations regarding toxicity and environmental impact should be taken into account when handling this substance.

Formula: C₁₅H₁₇NO₂

InChI: InChI=1S/C15H17NO2/c1-10-4-6-14(15(8-10)17-3)18-13-7-5-12(16)9-11(13)2/h4-9H,16H2,1-3H3

InChI key: InChIKey=PFYGADIHUISKLV-UHFFFAOYSA-N

SMILES: O(C1=C(OC)C=C(C)C=C1)C2=C(C)C=C(N)C=C2

Synonyms:

• 4-(2-Methoxy-4-methylphenoxy)-3-methylbenzenamine
• Benzenamine, 4-(2-methoxy-4-methylphenoxy)-3-methyl-