
CAS 946699-04-3
:4-(2-Ethoxyphenoxy)-3-fluorobenzenamine
Description:
4-(2-Ethoxyphenoxy)-3-fluorobenzenamine is an organic compound characterized by its complex structure, which includes a fluorobenzene moiety, an ethoxy group, and an amine functional group. The presence of the fluorine atom typically enhances the compound's lipophilicity and may influence its reactivity and biological activity. The ethoxyphenoxy group contributes to the compound's overall hydrophobic character, which can affect its solubility in various solvents. This compound may exhibit interesting properties such as potential biological activity, making it of interest in pharmaceutical research. Its amine group can participate in hydrogen bonding, influencing its interactions with other molecules. Additionally, the compound's structure suggests potential applications in medicinal chemistry, particularly in the development of new therapeutic agents. However, specific characteristics such as melting point, boiling point, and solubility would require empirical data for precise evaluation. Overall, 4-(2-Ethoxyphenoxy)-3-fluorobenzenamine represents a unique chemical entity with potential applications in various fields of chemistry and biology.
Formula:C14H14FNO2
InChI:InChI=1S/C14H14FNO2/c1-2-17-13-5-3-4-6-14(13)18-12-8-7-10(16)9-11(12)15/h3-9H,2,16H2,1H3
InChI key:InChIKey=RRUDEJBHYPSYIJ-UHFFFAOYSA-N
SMILES:O(C1=C(OCC)C=CC=C1)C2=C(F)C=C(N)C=C2
Synonyms:- Benzenamine, 4-(2-ethoxyphenoxy)-3-fluoro-
- 4-(2-Ethoxyphenoxy)-3-fluorobenzenamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.