CAS 946699-39-4
:4-(2-Furanylmethoxy)-2-methylbenzenamine
Description:
4-(2-Furanylmethoxy)-2-methylbenzenamine, identified by its CAS number 946699-39-4, is an organic compound characterized by the presence of both a furan ring and an amine functional group. This compound features a methoxy linkage connecting the furan moiety to a substituted aniline structure, specifically a 2-methylbenzenamine. The furan ring contributes to its aromatic properties, while the amine group can participate in hydrogen bonding, influencing its solubility and reactivity. The presence of the methyl group on the benzene ring can affect the compound's electronic properties and steric hindrance, potentially impacting its biological activity and interactions. This compound may exhibit interesting pharmacological properties, making it a candidate for further research in medicinal chemistry. Its synthesis and characterization would typically involve standard organic reactions, and its stability and reactivity would be influenced by the functional groups present. Overall, 4-(2-Furanylmethoxy)-2-methylbenzenamine represents a unique structure that could be of interest in various chemical and pharmaceutical applications.
Formula:C12H13NO2
InChI:InChI=1S/C12H13NO2/c1-9-7-10(4-5-12(9)13)15-8-11-3-2-6-14-11/h2-7H,8,13H2,1H3
InChI key:InChIKey=ZDIKOLZXUHOYQZ-UHFFFAOYSA-N
SMILES:O(CC1=CC=CO1)C2=CC(C)=C(N)C=C2
Synonyms:- Benzenamine, 4-(2-furanylmethoxy)-2-methyl-
- 4-(2-Furanylmethoxy)-2-methylbenzenamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.