CAS 946699-75-8
:2-Methyl-4-(4-methylphenoxy)benzenamine
Description:
2-Methyl-4-(4-methylphenoxy)benzenamine, identified by its CAS number 946699-75-8, is an organic compound characterized by its aromatic amine structure. This substance features a benzene ring substituted with both a methyl group and a phenoxy group, which contributes to its chemical properties. The presence of the amine functional group indicates that it can participate in hydrogen bonding, influencing its solubility and reactivity. Typically, compounds of this nature exhibit moderate to low solubility in water but may be more soluble in organic solvents. The methyl groups can enhance hydrophobic interactions, potentially affecting the compound's biological activity and stability. Additionally, due to the presence of the amine group, this compound may exhibit basic properties and can act as a nucleophile in various chemical reactions. Its specific applications may vary, but compounds with similar structures are often explored in fields such as pharmaceuticals, agrochemicals, and materials science. Safety data should be consulted for handling and potential toxicity, as aromatic amines can pose health risks.
Formula:C14H15NO
InChI:InChI=1S/C14H15NO/c1-10-3-5-12(6-4-10)16-13-7-8-14(15)11(2)9-13/h3-9H,15H2,1-2H3
InChI key:InChIKey=NPNGZRWBRIXCPA-UHFFFAOYSA-N
SMILES:O(C1=CC(C)=C(N)C=C1)C2=CC=C(C)C=C2
Synonyms:- 2-Methyl-4-(4-methylphenoxy)benzenamine
- 2-Methyl-4-(4-methylphenoxy)aniline
- Benzenamine, 2-methyl-4-(4-methylphenoxy)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.