CymitQuimica logo

CAS 946706-58-7

:

2-(ethylamino)pyrimidine-5-carboxylic acid

Description:
2-(Ethylamino)pyrimidine-5-carboxylic acid is a chemical compound characterized by its pyrimidine ring structure, which is a six-membered aromatic heterocycle containing two nitrogen atoms at positions 1 and 3. This compound features an ethylamino group attached to the second carbon of the pyrimidine ring and a carboxylic acid functional group at the fifth position. The presence of the ethylamino group contributes to its basicity and potential for forming hydrogen bonds, while the carboxylic acid group provides acidic properties, making it a zwitterionic compound under certain conditions. This compound may exhibit solubility in polar solvents due to its functional groups, and it can participate in various chemical reactions typical of amino acids and carboxylic acids. Its unique structure suggests potential applications in pharmaceuticals, particularly in the development of biologically active molecules or as intermediates in organic synthesis. As with many pyrimidine derivatives, it may also exhibit interesting biological activities, warranting further investigation in medicinal chemistry.
Formula:C7H9N3O2
InChI:InChI=1/C7H9N3O2/c1-2-8-7-9-3-5(4-10-7)6(11)12/h3-4H,2H2,1H3,(H,11,12)(H,8,9,10)
SMILES:CCN=c1[nH]cc(cn1)C(=O)O
Synonyms:
  • 5-Pyrimidinecarboxylic Acid, 2-(Ethylamino)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.